Products 2096334-14-2

CAS 2096334-14-2 is the registry number for 3-Ethoxy-2-fluoro-4-methoxyphenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g.

Structural formula: {0} (CAS {1})

(3-ethoxy-2-fluoro-4-methoxyphenyl)boronic acid (CAS 2096334-14-2) is a chemical compound with the molecular formula C9H12BFO4 and a molecular weight of 214.00 g/mol. IUPAC name: (3-ethoxy-2-fluoro-4-methoxyphenyl)boronic acid. InChIKey: QERDQGGEVQJWKL-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12BFO4
Molecular weight214.00 g/mol
IUPAC name(3-ethoxy-2-fluoro-4-methoxyphenyl)boronic acid
InChIKeyQERDQGGEVQJWKL-UHFFFAOYSA-N
SMILESB(C1=C(C(=C(C=C1)OC)OCC)F)(O)O

Computed by PubChem (NCBI)