CAS 2096334-46-0 is the registry number for Indoline-5-boronic acid, pinacol ester hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-indole;hydrochloride (CAS 2096334-46-0) is a chemical compound with the molecular formula C14H21BClNO2 and a molecular weight of 281.59 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-indole;hydrochloride. InChIKey: FTRRYGMRLGGOGZ-UHFFFAOYSA-N.
| Molecular formula | C14H21BClNO2 |
|---|---|
| Molecular weight | 281.59 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-indole;hydrochloride |
| InChIKey | FTRRYGMRLGGOGZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)NCC3.Cl |
Computed by PubChem (NCBI)