CAS 2096334-54-0 is the registry number for 5-Bromo-4-fluoro-2,3-methylenedioxyphenylboronic acid, pinacol ester, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
2-(6-bromo-7-fluoro-1,3-benzodioxol-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2096334-54-0) is a chemical compound with the molecular formula C13H15BBrFO4 and a molecular weight of 344.97 g/mol. IUPAC name: 2-(6-bromo-7-fluoro-1,3-benzodioxol-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: MQIFCUNYOGZZBA-UHFFFAOYSA-N.
| Molecular formula | C13H15BBrFO4 |
|---|---|
| Molecular weight | 344.97 g/mol |
| IUPAC name | 2-(6-bromo-7-fluoro-1,3-benzodioxol-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | MQIFCUNYOGZZBA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C3=C2OCO3)F)Br |
Computed by PubChem (NCBI)