CAS 2096334-75-5 is the registry number for 3–(2,5–Dimethylphenylcarbamoyl)–4–fluorobenzeneboronic acid. Offered by: GLPBio. Available pack sizes: 100mg.
[3-[(2,5-dimethylphenyl)carbamoyl]-4-fluorophenyl]boronic acid (CAS 2096334-75-5) is a chemical compound with the molecular formula C15H15BFNO3 and a molecular weight of 287.10 g/mol. IUPAC name: [3-[(2,5-dimethylphenyl)carbamoyl]-4-fluorophenyl]boronic acid. InChIKey: ITTKZMHMESMYEV-UHFFFAOYSA-N.
| Molecular formula | C15H15BFNO3 |
|---|---|
| Molecular weight | 287.10 g/mol |
| IUPAC name | [3-[(2,5-dimethylphenyl)carbamoyl]-4-fluorophenyl]boronic acid |
| InChIKey | ITTKZMHMESMYEV-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)F)C(=O)NC2=C(C=CC(=C2)C)C)(O)O |
Computed by PubChem (NCBI)