CAS 2096336-78-4 is the registry number for {3-[2-Amino-4-(trifluoromethyl)phenoxy]phenyl}boronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
[3-[2-amino-4-(trifluoromethyl)phenoxy]phenyl]boronic acid (CAS 2096336-78-4) is a chemical compound with the molecular formula C13H11BF3NO3 and a molecular weight of 297.04 g/mol. IUPAC name: [3-[2-amino-4-(trifluoromethyl)phenoxy]phenyl]boronic acid. InChIKey: NSYBJNOSWRNVBT-UHFFFAOYSA-N.
| Molecular formula | C13H11BF3NO3 |
|---|---|
| Molecular weight | 297.04 g/mol |
| IUPAC name | [3-[2-amino-4-(trifluoromethyl)phenoxy]phenyl]boronic acid |
| InChIKey | NSYBJNOSWRNVBT-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)OC2=C(C=C(C=C2)C(F)(F)F)N)(O)O |
Computed by PubChem (NCBI)