Products 2096337-24-3

CAS 2096337-24-3 appears in our catalog under these names: 2,4-Dichloro-5-(pyridin-3-ylmethoxy)phenylboronic acid, 97%, (2,4-Dichloro-5-(pyridin-3-ylmethoxy)phenyl)boronic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

[2,4-dichloro-5-(pyridin-3-ylmethoxy)phenyl]boronic acid (CAS 2096337-24-3) is a chemical compound with the molecular formula C12H10BCl2NO3 and a molecular weight of 297.9 g/mol. IUPAC name: [2,4-dichloro-5-(pyridin-3-ylmethoxy)phenyl]boronic acid. InChIKey: PWXWJXKJHPZREU-UHFFFAOYSA-N.

Identity
Molecular formulaC12H10BCl2NO3
Molecular weight297.9 g/mol
IUPAC name[2,4-dichloro-5-(pyridin-3-ylmethoxy)phenyl]boronic acid
InChIKeyPWXWJXKJHPZREU-UHFFFAOYSA-N
SMILESB(C1=CC(=C(C=C1Cl)Cl)OCC2=CN=CC=C2)(O)O

Computed by PubChem (NCBI)