CAS 2096337-72-1 is the registry number for 3-Chloro-4,5-diethoxyphenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g.
(3-chloro-4,5-diethoxyphenyl)boronic acid (CAS 2096337-72-1) is a chemical compound with the molecular formula C10H14BClO4 and a molecular weight of 244.48 g/mol. IUPAC name: (3-chloro-4,5-diethoxyphenyl)boronic acid. InChIKey: MUWWSRMIIYKHNL-UHFFFAOYSA-N.
| Molecular formula | C10H14BClO4 |
|---|---|
| Molecular weight | 244.48 g/mol |
| IUPAC name | (3-chloro-4,5-diethoxyphenyl)boronic acid |
| InChIKey | MUWWSRMIIYKHNL-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)Cl)OCC)OCC)(O)O |
Computed by PubChem (NCBI)