CAS 2096338-10-0 appears in our catalog under these names: 2-[N-(Methoxymethyl)methanesulfonamido]pyrimidine-5-boronic acid, 95%, (2-(N-(Methoxymethyl)methylsulfonamido)pyrimidin-5-yl)boronic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 100mg.
[2-[methoxymethyl(methylsulfonyl)amino]pyrimidin-5-yl]boronic acid (CAS 2096338-10-0) is a chemical compound with the molecular formula C7H12BN3O5S and a molecular weight of 261.07 g/mol. IUPAC name: [2-[methoxymethyl(methylsulfonyl)amino]pyrimidin-5-yl]boronic acid. InChIKey: RYRQEIDSFOYTPH-UHFFFAOYSA-N.
| Molecular formula | C7H12BN3O5S |
|---|---|
| Molecular weight | 261.07 g/mol |
| IUPAC name | [2-[methoxymethyl(methylsulfonyl)amino]pyrimidin-5-yl]boronic acid |
| InChIKey | RYRQEIDSFOYTPH-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(N=C1)N(COC)S(=O)(=O)C)(O)O |
Computed by PubChem (NCBI)