Products 2096338-53-1
CAS 2096338-53-1 is the registry number for 4-(Diphenylaminomethyl)benzeneboronic acid pinacol ester, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 25g, 1g.
N-phenyl-N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]aniline (CAS 2096338-53-1) is a chemical compound with the molecular formula C25H28BNO2 and a molecular weight of 385.3 g/mol. IUPAC name: N-phenyl-N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]aniline. InChIKey: JILAXDZBCWOJRT-UHFFFAOYSA-N.
| Molecular formula | C25H28BNO2 |
|---|---|
| Molecular weight | 385.3 g/mol |
| IUPAC name | N-phenyl-N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]aniline |
| InChIKey | JILAXDZBCWOJRT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)CN(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)