CAS 2096338-85-9 appears in our catalog under these names: 3-Bromo-5-(4-methylpiperazino)phenylboronic acid, 95%, (3-Bromo-5-(4-methylpiperazin-1-yl)phenyl)boronic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 25g.
[3-bromo-5-(4-methylpiperazin-1-yl)phenyl]boronic acid (CAS 2096338-85-9) is a chemical compound with the molecular formula C11H16BBrN2O2 and a molecular weight of 298.97 g/mol. IUPAC name: [3-bromo-5-(4-methylpiperazin-1-yl)phenyl]boronic acid. InChIKey: OQKNZFDVGKUFHR-UHFFFAOYSA-N.
| Molecular formula | C11H16BBrN2O2 |
|---|---|
| Molecular weight | 298.97 g/mol |
| IUPAC name | [3-bromo-5-(4-methylpiperazin-1-yl)phenyl]boronic acid |
| InChIKey | OQKNZFDVGKUFHR-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)Br)N2CCN(CC2)C)(O)O |
Computed by PubChem (NCBI)