CAS 2096339-19-2 is the registry number for 4-(Cyclopropylsulfamoyl)-2-(trifluoromethyl)phenylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
[4-(cyclopropylsulfamoyl)-2-(trifluoromethyl)phenyl]boronic acid (CAS 2096339-19-2) is a chemical compound with the molecular formula C10H11BF3NO4S and a molecular weight of 309.07 g/mol. IUPAC name: [4-(cyclopropylsulfamoyl)-2-(trifluoromethyl)phenyl]boronic acid. InChIKey: SYAZEHHNBCETRG-UHFFFAOYSA-N.
| Molecular formula | C10H11BF3NO4S |
|---|---|
| Molecular weight | 309.07 g/mol |
| IUPAC name | [4-(cyclopropylsulfamoyl)-2-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | SYAZEHHNBCETRG-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)S(=O)(=O)NC2CC2)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)