CAS 2096339-42-1 is the registry number for 4'-Chlorobenzanilide-4-boronic acid pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
N-(4-chlorophenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (CAS 2096339-42-1) is a chemical compound with the molecular formula C19H21BClNO3 and a molecular weight of 357.6 g/mol. IUPAC name: N-(4-chlorophenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide. InChIKey: VQRALZPLWWICTD-UHFFFAOYSA-N.
| Molecular formula | C19H21BClNO3 |
|---|---|
| Molecular weight | 357.6 g/mol |
| IUPAC name | N-(4-chlorophenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| InChIKey | VQRALZPLWWICTD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(=O)NC3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)