CAS 2096339-49-8 appears in our catalog under these names: [3-(Pyridin-3-ylmethoxy)-4-(trifluoromethoxy)phenyl]boronic acid, 98%, (3-(Pyridin-3-ylmethoxy)-4-(trifluoromethoxy)phenyl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
[3-(pyridin-3-ylmethoxy)-4-(trifluoromethoxy)phenyl]boronic acid (CAS 2096339-49-8) is a chemical compound with the molecular formula C13H11BF3NO4 and a molecular weight of 313.04 g/mol. IUPAC name: [3-(pyridin-3-ylmethoxy)-4-(trifluoromethoxy)phenyl]boronic acid. InChIKey: FHOXZCDWRIFWPA-UHFFFAOYSA-N.
| Molecular formula | C13H11BF3NO4 |
|---|---|
| Molecular weight | 313.04 g/mol |
| IUPAC name | [3-(pyridin-3-ylmethoxy)-4-(trifluoromethoxy)phenyl]boronic acid |
| InChIKey | FHOXZCDWRIFWPA-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OC(F)(F)F)OCC2=CN=CC=C2)(O)O |
Computed by PubChem (NCBI)