CAS 2096339-71-6 appears in our catalog under these names: 3-(1-Cyanocyclopentyl)-2-fluorophenylboronic acid, 98%, (3-(1-Cyanocyclopentyl)-2-fluorophenyl)boronic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
[3-(1-cyanocyclopentyl)-2-fluorophenyl]boronic acid (CAS 2096339-71-6) is a chemical compound with the molecular formula C12H13BFNO2 and a molecular weight of 233.05 g/mol. IUPAC name: [3-(1-cyanocyclopentyl)-2-fluorophenyl]boronic acid. InChIKey: GWVDFQFORBSFKG-UHFFFAOYSA-N.
| Molecular formula | C12H13BFNO2 |
|---|---|
| Molecular weight | 233.05 g/mol |
| IUPAC name | [3-(1-cyanocyclopentyl)-2-fluorophenyl]boronic acid |
| InChIKey | GWVDFQFORBSFKG-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)C2(CCCC2)C#N)F)(O)O |
Computed by PubChem (NCBI)