Products 2096339-81-8

CAS 2096339-81-8 is the registry number for 3-(Pentyloxy)-5-(trifluoromethoxy)phenylboronic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

[3-pentoxy-5-(trifluoromethoxy)phenyl]boronic acid (CAS 2096339-81-8) is a chemical compound with the molecular formula C12H16BF3O4 and a molecular weight of 292.06 g/mol. IUPAC name: [3-pentoxy-5-(trifluoromethoxy)phenyl]boronic acid. InChIKey: KPXIDLPMGPLNPS-UHFFFAOYSA-N.

Identity
Molecular formulaC12H16BF3O4
Molecular weight292.06 g/mol
IUPAC name[3-pentoxy-5-(trifluoromethoxy)phenyl]boronic acid
InChIKeyKPXIDLPMGPLNPS-UHFFFAOYSA-N
SMILESB(C1=CC(=CC(=C1)OC(F)(F)F)OCCCCC)(O)O

Computed by PubChem (NCBI)