CAS 2096340-07-5 is the registry number for 3-Chloro-2-(N-isopropylaminomethyl)phenylboronic acid, pinacol ester, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
N-[[2-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]propan-2-amine (CAS 2096340-07-5) is a chemical compound with the molecular formula C16H25BClNO2 and a molecular weight of 309.6 g/mol. IUPAC name: N-[[2-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]propan-2-amine. InChIKey: RZZFFGWXJFOBOU-UHFFFAOYSA-N.
| Molecular formula | C16H25BClNO2 |
|---|---|
| Molecular weight | 309.6 g/mol |
| IUPAC name | N-[[2-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]propan-2-amine |
| InChIKey | RZZFFGWXJFOBOU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC=C2)Cl)CNC(C)C |
Computed by PubChem (NCBI)