CAS 2096492-41-8 appears in our catalog under these names: Apremilast Impurity T, Apremilast Impurity 15, Apremilast Impurity 10, Apremilast open ring 3-acetamide. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg, 25mg.
3-acetamido-2-[[(1S)-1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]carbamoyl]benzoic acid (CAS 2096492-41-8) is a chemical compound with the molecular formula C22H26N2O8S and a molecular weight of 478.5 g/mol. IUPAC name: 3-acetamido-2-[[(1S)-1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]carbamoyl]benzoic acid. InChIKey: KHUBRTTVUSOROB-QGZVFWFLSA-N.
| Molecular formula | C22H26N2O8S |
|---|---|
| Molecular weight | 478.5 g/mol |
| IUPAC name | 3-acetamido-2-[[(1S)-1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]carbamoyl]benzoic acid |
| InChIKey | KHUBRTTVUSOROB-QGZVFWFLSA-N |
| SMILES | CCOC1=C(C=CC(=C1)[C@@H](CS(=O)(=O)C)NC(=O)C2=C(C=CC=C2NC(=O)C)C(=O)O)OC |
Computed by PubChem (NCBI)