CAS 209664-72-2 appears in our catalog under these names: Potassium 2-amino-5-nitrobenzoate, 98+%, 2-Amino-5-nitrobenzoic acid potassium salt, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 1g, 500g, 25g, 100g, 5g.
Potassium 2-amino-5-nitrobenzoate (CAS 209664-72-2) is a chemical compound with the molecular formula C7H5KN2O4 and a molecular weight of 220.22 g/mol. IUPAC name: potassium 2-amino-5-nitrobenzoate. InChIKey: VUOPWTVKTDYMCB-UHFFFAOYSA-M.
| Molecular formula | C7H5KN2O4 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | potassium 2-amino-5-nitrobenzoate |
| InChIKey | VUOPWTVKTDYMCB-UHFFFAOYSA-M |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])C(=O)[O-])N.[K+] |
Computed by PubChem (NCBI)