Products 2096984-25-5

CAS 2096984-25-5 is the registry number for Lipid III–45. Offered by: GLPBio. Available pack sizes: 25mg, 10mg, 50mg.

Structural formula: {0} (CAS {1})

9-[9-(2-butyloctanoyloxy)nonyl-(3-hydroxypropyl)amino]nonyl 2-butyloctanoate (CAS 2096984-25-5) is a chemical compound with the molecular formula C45H89NO5 and a molecular weight of 724.2 g/mol. IUPAC name: 9-[9-(2-butyloctanoyloxy)nonyl-(3-hydroxypropyl)amino]nonyl 2-butyloctanoate. InChIKey: WKWZZCCOOBPOOA-UHFFFAOYSA-N.

Identity
Molecular formulaC45H89NO5
Molecular weight724.2 g/mol
IUPAC name9-[9-(2-butyloctanoyloxy)nonyl-(3-hydroxypropyl)amino]nonyl 2-butyloctanoate
InChIKeyWKWZZCCOOBPOOA-UHFFFAOYSA-N
SMILESCCCCCCC(CCCC)C(=O)OCCCCCCCCCN(CCCCCCCCCOC(=O)C(CCCC)CCCCCC)CCCO

Computed by PubChem (NCBI)