CAS 2096987-15-2 is the registry number for 2-Bromo-n-(2-chloro-4,6-dimethoxyphenyl)acetamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-bromo-N-(2-chloro-4,6-dimethoxyphenyl)acetamide (CAS 2096987-15-2) is a chemical compound with the molecular formula C10H11BrClNO3 and a molecular weight of 308.55 g/mol. IUPAC name: 2-bromo-N-(2-chloro-4,6-dimethoxyphenyl)acetamide. InChIKey: QSYUGRKHMSRGHW-UHFFFAOYSA-N.
| Molecular formula | C10H11BrClNO3 |
|---|---|
| Molecular weight | 308.55 g/mol |
| IUPAC name | 2-bromo-N-(2-chloro-4,6-dimethoxyphenyl)acetamide |
| InChIKey | QSYUGRKHMSRGHW-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)Cl)NC(=O)CBr)OC |
Computed by PubChem (NCBI)