CAS 2096995-77-4 is the registry number for 2,3,5,6-Tetramethoxypyridine-4-boronic acid pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2,3,5,6-tetramethoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 2096995-77-4) is a chemical compound with the molecular formula C15H24BNO6 and a molecular weight of 325.17 g/mol. IUPAC name: 2,3,5,6-tetramethoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: HFGRCPJXQVCNSG-UHFFFAOYSA-N.
| Molecular formula | C15H24BNO6 |
|---|---|
| Molecular weight | 325.17 g/mol |
| IUPAC name | 2,3,5,6-tetramethoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | HFGRCPJXQVCNSG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=NC(=C2OC)OC)OC)OC |
Computed by PubChem (NCBI)