CAS 2096998-65-9 is the registry number for 1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]heptan-1-one, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]heptan-1-one (CAS 2096998-65-9) is a chemical compound with the molecular formula C19H29BO3 and a molecular weight of 316.2 g/mol. IUPAC name: 1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]heptan-1-one. InChIKey: JYWKARHVUMOAQV-UHFFFAOYSA-N.
| Molecular formula | C19H29BO3 |
|---|---|
| Molecular weight | 316.2 g/mol |
| IUPAC name | 1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]heptan-1-one |
| InChIKey | JYWKARHVUMOAQV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C(=O)CCCCCC |
Computed by PubChem (NCBI)