CAS 2097065-09-1 appears in our catalog under these names: (3-Bromo-5-fluorophenyl)(5-chloropyridin-2-yl)methanone, 95%, (3-bromo-5-fluorophenyl)(5-chloropyridin-2-yl)methanone, ≥95%, ≥95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 10g, 1g, 250mg.
(3-bromo-5-fluorophenyl)-(5-chloro-2-pyridinyl)methanone (CAS 2097065-09-1) is a chemical compound with the molecular formula C12H6BrClFNO and a molecular weight of 314.54 g/mol. IUPAC name: (3-bromo-5-fluorophenyl)-(5-chloro-2-pyridinyl)methanone. InChIKey: BXQBGCTVAZAETG-UHFFFAOYSA-N.
| Molecular formula | C12H6BrClFNO |
|---|---|
| Molecular weight | 314.54 g/mol |
| IUPAC name | (3-bromo-5-fluorophenyl)-(5-chloro-2-pyridinyl)methanone |
| InChIKey | BXQBGCTVAZAETG-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1Cl)C(=O)C2=CC(=CC(=C2)Br)F |
Computed by PubChem (NCBI)