CAS 20971-43-1 is the registry number for 6,8-Disulfo-2-naphthalenediazonium. Offered by: TRC, Biosynth. Available pack sizes: 1g, 1000mg.
6,8-disulfonaphthalene-2-diazonium (CAS 20971-43-1) is a chemical compound with the molecular formula C10H7N2O6S2+ and a molecular weight of 315.3 g/mol. IUPAC name: 6,8-disulfonaphthalene-2-diazonium. InChIKey: BOFZSDWEKQWLMP-UHFFFAOYSA-O.
| Molecular formula | C10H7N2O6S2+ |
|---|---|
| Molecular weight | 315.3 g/mol |
| IUPAC name | 6,8-disulfonaphthalene-2-diazonium |
| InChIKey | BOFZSDWEKQWLMP-UHFFFAOYSA-O |
| SMILES | C1=CC(=CC2=C(C=C(C=C21)S(=O)(=O)O)S(=O)(=O)O)[N+]#N |
Computed by PubChem (NCBI)