CAS 2097124-40-6 appears in our catalog under these names: 2'-Bromo-10,10-dimethyl-10H-spiro[anthracene-9,9'-fluorene], 95%, 95%, 2'-Bromo-10,10-dimethyl-10H-spiro[anthracene-9,9'-fluorene], 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g.
2'-bromo-9,9-dimethylspiro[anthracene-10,9'-fluorene] (CAS 2097124-40-6) is a chemical compound with the molecular formula C28H21Br and a molecular weight of 437.4 g/mol. IUPAC name: 2'-bromo-9,9-dimethylspiro[anthracene-10,9'-fluorene]. InChIKey: ZJJIDBGGEMRXEE-UHFFFAOYSA-N.
| Molecular formula | C28H21Br |
|---|---|
| Molecular weight | 437.4 g/mol |
| IUPAC name | 2'-bromo-9,9-dimethylspiro[anthracene-10,9'-fluorene] |
| InChIKey | ZJJIDBGGEMRXEE-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2C3(C4=CC=CC=C4C5=C3C=C(C=C5)Br)C6=CC=CC=C61)C |
Computed by PubChem (NCBI)