Products 2097148-47-3
CAS 2097148-47-3 appears in our catalog under these names: MAO–B–IN–25, MAO-B-IN-25, 99.11%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 50mg, 50 mg, 10 mg, 10mM/1mL.
7-[(4-bromophenyl)methoxy]-3,4-dihydrochromen-2-one (CAS 2097148-47-3) is a chemical compound with the molecular formula C16H13BrO3 and a molecular weight of 333.18 g/mol. IUPAC name: 7-[(4-bromophenyl)methoxy]-3,4-dihydrochromen-2-one. InChIKey: AQXSKVNTZYUGFM-UHFFFAOYSA-N.
| Molecular formula | C16H13BrO3 |
|---|---|
| Molecular weight | 333.18 g/mol |
| IUPAC name | 7-[(4-bromophenyl)methoxy]-3,4-dihydrochromen-2-one |
| InChIKey | AQXSKVNTZYUGFM-UHFFFAOYSA-N |
| SMILES | C1CC(=O)OC2=C1C=CC(=C2)OCC3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)