CAS 175136-36-4 is the registry number for 1-(7-Bromo-2,3-dihydrobenzo[b][1,4]dioxin-6-yl)-2-phenylethanone, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-2-phenylethanone (CAS 175136-36-4) is a chemical compound with the molecular formula C16H13BrO3 and a molecular weight of 333.18 g/mol. IUPAC name: 1-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-2-phenylethanone. InChIKey: JKMNAXMPRIKLNS-UHFFFAOYSA-N.
| Molecular formula | C16H13BrO3 |
|---|---|
| Molecular weight | 333.18 g/mol |
| IUPAC name | 1-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-2-phenylethanone |
| InChIKey | JKMNAXMPRIKLNS-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=C(C(=C2)Br)C(=O)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)