CAS 2097164-99-1 is the registry number for tert-Butyl ((4-bromo-5-chloro-2-fluorophenyl)sulfonyl)(thiazol-4-yl)carbamate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-(4-bromo-5-chloro-2-fluorophenyl)sulfonyl-N-(1,3-thiazol-4-yl)carbamate (CAS 2097164-99-1) is a chemical compound with the molecular formula C14H13BrClFN2O4S2 and a molecular weight of 471.8 g/mol. IUPAC name: tert-butyl N-(4-bromo-5-chloro-2-fluorophenyl)sulfonyl-N-(1,3-thiazol-4-yl)carbamate. InChIKey: ITTBFFWVDWKOGR-UHFFFAOYSA-N.
| Molecular formula | C14H13BrClFN2O4S2 |
|---|---|
| Molecular weight | 471.8 g/mol |
| IUPAC name | tert-butyl N-(4-bromo-5-chloro-2-fluorophenyl)sulfonyl-N-(1,3-thiazol-4-yl)carbamate |
| InChIKey | ITTBFFWVDWKOGR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C1=CSC=N1)S(=O)(=O)C2=CC(=C(C=C2F)Br)Cl |
Computed by PubChem (NCBI)