CAS 209728-15-4 appears in our catalog under these names: 3-Hydroxypyruvic Acid Lithium Salt (>80%), Hydroxypyruvic acid lithium hydrate, Hydroxypyruvic acid lithium hydrate, Hydroxypyruvic acid (lithium hydrate). Offered by: TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 100mg, 50mg, 1mg, 5mg, 500mg, 250mg, Get quote.
Lithium;3-hydroxy-2-oxopropanoate;hydrate (CAS 209728-15-4) is a chemical compound with the molecular formula C3H5LiO5 and a molecular weight of 128.0 g/mol. IUPAC name: lithium;3-hydroxy-2-oxopropanoate;hydrate. InChIKey: YHTVWBANKNBEKJ-UHFFFAOYSA-M.
| Molecular formula | C3H5LiO5 |
|---|---|
| Molecular weight | 128.0 g/mol |
| IUPAC name | lithium;3-hydroxy-2-oxopropanoate;hydrate |
| InChIKey | YHTVWBANKNBEKJ-UHFFFAOYSA-M |
| SMILES | [Li+].C(C(=O)C(=O)[O-])O.O |
Computed by PubChem (NCBI)