CAS 2097360-69-3 is the registry number for (S)-1-(2-Fluorophenyl)-4,5,6,7-tetrahydro-1H-indazol-4-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4S)-1-(2-fluorophenyl)-4,5,6,7-tetrahydroindazol-4-amine (CAS 2097360-69-3) is a chemical compound with the molecular formula C13H14FN3 and a molecular weight of 231.27 g/mol. IUPAC name: (4S)-1-(2-fluorophenyl)-4,5,6,7-tetrahydroindazol-4-amine. InChIKey: HSWNJHBLQQJBQU-NSHDSACASA-N.
| Molecular formula | C13H14FN3 |
|---|---|
| Molecular weight | 231.27 g/mol |
| IUPAC name | (4S)-1-(2-fluorophenyl)-4,5,6,7-tetrahydroindazol-4-amine |
| InChIKey | HSWNJHBLQQJBQU-NSHDSACASA-N |
| SMILES | C1C[C@@H](C2=C(C1)N(N=C2)C3=CC=CC=C3F)N |
Computed by PubChem (NCBI)