CAS 2097446-27-8 appears in our catalog under these names: 2,5-Dihydroxybenzoic Acid Sodium Salt Hydrate, 95%, Gentisic acid sodium salt hydrate, Gentisic acid sodium salt hydrate, min. 95 %, 50 g, Gentisic acid sodium salt hydrate, min. 95 %, 100 g, Gentisic acid sodium salt hydrate, min. 95 %, 250 g. Offered by: Chemat Brand, Biosynth, Roth. Available pack sizes: on request, 50g, 100g, 250g, 500g.
Sodium;2,5-dihydroxybenzoate;hydrate (CAS 2097446-27-8) is a chemical compound with the molecular formula C7H7NaO5 and a molecular weight of 194.12 g/mol. IUPAC name: sodium;2,5-dihydroxybenzoate;hydrate. InChIKey: SYGYBOPDUUSVNE-UHFFFAOYSA-M.
| Molecular formula | C7H7NaO5 |
|---|---|
| Molecular weight | 194.12 g/mol |
| IUPAC name | sodium;2,5-dihydroxybenzoate;hydrate |
| InChIKey | SYGYBOPDUUSVNE-UHFFFAOYSA-M |
| SMILES | C1=CC(=C(C=C1O)C(=O)[O-])O.O.[Na+] |
Computed by PubChem (NCBI)