CAS 2097523-45-8 is the registry number for Adenine Threose Triphosphate Sodium Salt . Offered by: TRC. Available pack sizes: 10mg.
CAS 2097523-45-8 identifies a chemical compound with the molecular formula C9H10N5NaO12P3-4 and a molecular weight of 496.11 g/mol. InChIKey: QTDZEBLUXUWAAI-YYXCJWOLSA-J.
| Molecular formula | C9H10N5NaO12P3-4 |
|---|---|
| Molecular weight | 496.11 g/mol |
| InChIKey | QTDZEBLUXUWAAI-YYXCJWOLSA-J |
| SMILES | C1[C@@H]([C@H]([C@@H](O1)N2C=NC3=C(N=CN=C32)N)O)OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-].[Na] |
Computed by PubChem (NCBI)