CAS 2097816-16-3 is the registry number for 4-Bromo-7-fluoroquinolin-2(1H)-one. Offered by: AmBeed. Available pack sizes: 250mg, 1g.
4-bromo-7-fluoro-1H-quinolin-2-one (CAS 2097816-16-3) is a chemical compound with the molecular formula C9H5BrFNO and a molecular weight of 242.04 g/mol. IUPAC name: 4-bromo-7-fluoro-1H-quinolin-2-one. InChIKey: CEHSKYFUMIZYGG-UHFFFAOYSA-N.
| Molecular formula | C9H5BrFNO |
|---|---|
| Molecular weight | 242.04 g/mol |
| IUPAC name | 4-bromo-7-fluoro-1H-quinolin-2-one |
| InChIKey | CEHSKYFUMIZYGG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)NC(=O)C=C2Br |
Computed by PubChem (NCBI)