CAS 2097925-52-3 is the registry number for RS6212, 98.86%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 10 mg, 100 mg, 25 mg, 10mM/1mL, 50 mg.
2-[[1-(1,1-dioxo-1,2-benzothiazol-3-yl)piperidin-4-yl]methyl]-6,7-dihydro-5H-cyclopenta[c]pyridazin-3-one (CAS 2097925-52-3) is a chemical compound with the molecular formula C20H22N4O3S and a molecular weight of 398.5 g/mol. IUPAC name: 2-[[1-(1,1-dioxo-1,2-benzothiazol-3-yl)piperidin-4-yl]methyl]-6,7-dihydro-5H-cyclopenta[c]pyridazin-3-one. InChIKey: NLYIQDCNUYJYRJ-UHFFFAOYSA-N.
| Molecular formula | C20H22N4O3S |
|---|---|
| Molecular weight | 398.5 g/mol |
| IUPAC name | 2-[[1-(1,1-dioxo-1,2-benzothiazol-3-yl)piperidin-4-yl]methyl]-6,7-dihydro-5H-cyclopenta[c]pyridazin-3-one |
| InChIKey | NLYIQDCNUYJYRJ-UHFFFAOYSA-N |
| SMILES | C1CC2=CC(=O)N(N=C2C1)CC3CCN(CC3)C4=NS(=O)(=O)C5=CC=CC=C54 |
Computed by PubChem (NCBI)