Products 2097936-37-1

CAS 2097936-37-1 is the registry number for 7-(2-Fluorophenyl)-1,4-thiazepane 1,1-dioxide hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

7-(2-fluorophenyl)-1,4-thiazepane 1,1-dioxide;hydrochloride (CAS 2097936-37-1) is a chemical compound with the molecular formula C11H15ClFNO2S and a molecular weight of 279.76 g/mol. IUPAC name: 7-(2-fluorophenyl)-1,4-thiazepane 1,1-dioxide;hydrochloride. InChIKey: XDKOVXUCYSSCRH-UHFFFAOYSA-N.

Identity
Molecular formulaC11H15ClFNO2S
Molecular weight279.76 g/mol
IUPAC name7-(2-fluorophenyl)-1,4-thiazepane 1,1-dioxide;hydrochloride
InChIKeyXDKOVXUCYSSCRH-UHFFFAOYSA-N
SMILESC1CNCCS(=O)(=O)C1C2=CC=CC=C2F.Cl

Computed by PubChem (NCBI)