Products 2097936-52-0
CAS 2097936-52-0 is the registry number for 3-(4,4-Difluoropyrrolidin-2-yl)-5-methyl-1,2,4-oxadiazole hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(4,4-difluoropyrrolidin-2-yl)-5-methyl-1,2,4-oxadiazole;hydrochloride (CAS 2097936-52-0) is a chemical compound with the molecular formula C7H10ClF2N3O and a molecular weight of 225.62 g/mol. IUPAC name: 3-(4,4-difluoropyrrolidin-2-yl)-5-methyl-1,2,4-oxadiazole;hydrochloride. InChIKey: LEXOKIHFRCZUGU-UHFFFAOYSA-N.
| Molecular formula | C7H10ClF2N3O |
|---|---|
| Molecular weight | 225.62 g/mol |
| IUPAC name | 3-(4,4-difluoropyrrolidin-2-yl)-5-methyl-1,2,4-oxadiazole;hydrochloride |
| InChIKey | LEXOKIHFRCZUGU-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NO1)C2CC(CN2)(F)F.Cl |
Computed by PubChem (NCBI)