Products 2097936-90-6
CAS 2097936-90-6 is the registry number for (1-Cyclopentyl-5-(pyridin-4-yl)-1H-pyrazol-3-yl)methanamine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1-cyclopentyl-5-pyridin-4-ylpyrazol-3-yl)methanamine (CAS 2097936-90-6) is a chemical compound with the molecular formula C14H18N4 and a molecular weight of 242.32 g/mol. IUPAC name: (1-cyclopentyl-5-pyridin-4-ylpyrazol-3-yl)methanamine. InChIKey: NGHQJJTYASXPEY-UHFFFAOYSA-N.
| Molecular formula | C14H18N4 |
|---|---|
| Molecular weight | 242.32 g/mol |
| IUPAC name | (1-cyclopentyl-5-pyridin-4-ylpyrazol-3-yl)methanamine |
| InChIKey | NGHQJJTYASXPEY-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)N2C(=CC(=N2)CN)C3=CC=NC=C3 |
Computed by PubChem (NCBI)