CAS 2097937-47-6 is the registry number for 5-(4-Fluoropyrrolidin-2-yl)-3-isopropyl-1,2,4-oxadiazole hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(4-fluoropyrrolidin-2-yl)-3-propan-2-yl-1,2,4-oxadiazole;hydrochloride (CAS 2097937-47-6) is a chemical compound with the molecular formula C9H15ClFN3O and a molecular weight of 235.68 g/mol. IUPAC name: 5-(4-fluoropyrrolidin-2-yl)-3-propan-2-yl-1,2,4-oxadiazole;hydrochloride. InChIKey: CAGNKSLJCGSFLW-UHFFFAOYSA-N.
| Molecular formula | C9H15ClFN3O |
|---|---|
| Molecular weight | 235.68 g/mol |
| IUPAC name | 5-(4-fluoropyrrolidin-2-yl)-3-propan-2-yl-1,2,4-oxadiazole;hydrochloride |
| InChIKey | CAGNKSLJCGSFLW-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NOC(=N1)C2CC(CN2)F.Cl |
Computed by PubChem (NCBI)