Products 2097944-83-5
CAS 2097944-83-5 is the registry number for 2-Amino-1-(3-ethoxy-3-(trifluoromethyl)azetidin-1-yl)propan-1-one. Offered by: Biosynth. Available pack sizes: 1000mg, 5000mg.
2-amino-1-[3-ethoxy-3-(trifluoromethyl)azetidin-1-yl]propan-1-one (CAS 2097944-83-5) is a chemical compound with the molecular formula C9H15F3N2O2 and a molecular weight of 240.22 g/mol. IUPAC name: 2-amino-1-[3-ethoxy-3-(trifluoromethyl)azetidin-1-yl]propan-1-one. InChIKey: ZZJZTMQWYXZYJQ-UHFFFAOYSA-N.
| Molecular formula | C9H15F3N2O2 |
|---|---|
| Molecular weight | 240.22 g/mol |
| IUPAC name | 2-amino-1-[3-ethoxy-3-(trifluoromethyl)azetidin-1-yl]propan-1-one |
| InChIKey | ZZJZTMQWYXZYJQ-UHFFFAOYSA-N |
| SMILES | CCOC1(CN(C1)C(=O)C(C)N)C(F)(F)F |
Computed by PubChem (NCBI)