Products 2097964-94-6

CAS 2097964-94-6 is the registry number for 1-(Difluoromethyl)-1H-pyrazole-4-carbonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-(difluoromethyl)pyrazole-4-carbonyl chloride (CAS 2097964-94-6) is a chemical compound with the molecular formula C5H3ClF2N2O and a molecular weight of 180.54 g/mol. IUPAC name: 1-(difluoromethyl)pyrazole-4-carbonyl chloride. InChIKey: MYYZVMOPKZJPSN-UHFFFAOYSA-N.

Identity
Molecular formulaC5H3ClF2N2O
Molecular weight180.54 g/mol
IUPAC name1-(difluoromethyl)pyrazole-4-carbonyl chloride
InChIKeyMYYZVMOPKZJPSN-UHFFFAOYSA-N
SMILESC1=C(C=NN1C(F)F)C(=O)Cl

Computed by PubChem (NCBI)