CAS 2098021-96-4 is the registry number for 3-(2-Azidoethyl)-2-methyl-4,5,6,7-tetrahydro-2H-indazole. Offered by: TRC. Available pack sizes: 2,5g.
3-(2-azidoethyl)-2-methyl-4,5,6,7-tetrahydroindazole (CAS 2098021-96-4) is a chemical compound with the molecular formula C10H15N5 and a molecular weight of 205.26 g/mol. IUPAC name: 3-(2-azidoethyl)-2-methyl-4,5,6,7-tetrahydroindazole. InChIKey: ZNUSDPPBVCWOCR-UHFFFAOYSA-N.
| Molecular formula | C10H15N5 |
|---|---|
| Molecular weight | 205.26 g/mol |
| IUPAC name | 3-(2-azidoethyl)-2-methyl-4,5,6,7-tetrahydroindazole |
| InChIKey | ZNUSDPPBVCWOCR-UHFFFAOYSA-N |
| SMILES | CN1C(=C2CCCCC2=N1)CCN=[N+]=[N-] |
Computed by PubChem (NCBI)