CAS 2098049-75-1 is the registry number for 5-((4-Bromo-1H-pyrazol-1-yl)methyl)-2,4-dimethylthiazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-[(4-bromopyrazol-1-yl)methyl]-2,4-dimethyl-1,3-thiazole (CAS 2098049-75-1) is a chemical compound with the molecular formula C9H10BrN3S and a molecular weight of 272.17 g/mol. IUPAC name: 5-[(4-bromopyrazol-1-yl)methyl]-2,4-dimethyl-1,3-thiazole. InChIKey: WWWOPMNDDPYLPS-UHFFFAOYSA-N.
| Molecular formula | C9H10BrN3S |
|---|---|
| Molecular weight | 272.17 g/mol |
| IUPAC name | 5-[(4-bromopyrazol-1-yl)methyl]-2,4-dimethyl-1,3-thiazole |
| InChIKey | WWWOPMNDDPYLPS-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C)CN2C=C(C=N2)Br |
Computed by PubChem (NCBI)