CAS 209808-47-9 appears in our catalog under these names: AR-M 1000390 hydrochloride/ 99.68% (existing batch purity), AR–M 1000390 hydrochloride, AR-M 1000390 hydrochloride, N,N-Diethyl-4-(phenyl(piperidin-4-ylidene)methyl)benzamide hydrochloride, 99.05%, 99.05%, AR-M 1000390 (hydrochloride), 98.20%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 5 mg, 10mM/1mL, 10 mg.
N,N-diethyl-4-[phenyl(piperidin-4-ylidene)methyl]benzamide;hydrochloride (CAS 209808-47-9) is a chemical compound with the molecular formula C23H29ClN2O and a molecular weight of 384.9 g/mol. IUPAC name: N,N-diethyl-4-[phenyl(piperidin-4-ylidene)methyl]benzamide;hydrochloride. InChIKey: OTXTZCLQEGSAMW-UHFFFAOYSA-N.
| Molecular formula | C23H29ClN2O |
|---|---|
| Molecular weight | 384.9 g/mol |
| IUPAC name | N,N-diethyl-4-[phenyl(piperidin-4-ylidene)methyl]benzamide;hydrochloride |
| InChIKey | OTXTZCLQEGSAMW-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)C1=CC=C(C=C1)C(=C2CCNCC2)C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)