Products 2098086-54-3
CAS 2098086-54-3 is the registry number for 1-(2-Chloro-4-methylphenyl)butan-1-amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-(2-chloro-4-methylphenyl)butan-1-amine;hydrochloride (CAS 2098086-54-3) is a chemical compound with the molecular formula C11H17Cl2N and a molecular weight of 234.16 g/mol. IUPAC name: 1-(2-chloro-4-methylphenyl)butan-1-amine;hydrochloride. InChIKey: QMZZTZMPYIKZKM-UHFFFAOYSA-N.
| Molecular formula | C11H17Cl2N |
|---|---|
| Molecular weight | 234.16 g/mol |
| IUPAC name | 1-(2-chloro-4-methylphenyl)butan-1-amine;hydrochloride |
| InChIKey | QMZZTZMPYIKZKM-UHFFFAOYSA-N |
| SMILES | CCCC(C1=C(C=C(C=C1)C)Cl)N.Cl |
Computed by PubChem (NCBI)