Products 2098196-05-3
CAS 2098196-05-3 is the registry number for (E)-3-(4-Bromophenyl)-1-(6-chloro-4-hydroxy-2-methoxypyridin-3-yl)prop-2-en-1-one, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-[(E)-3-(4-bromophenyl)prop-2-enoyl]-6-chloro-2-methoxy-1H-pyridin-4-one (CAS 2098196-05-3) is a chemical compound with the molecular formula C15H11BrClNO3 and a molecular weight of 368.61 g/mol. IUPAC name: 3-[(E)-3-(4-bromophenyl)prop-2-enoyl]-6-chloro-2-methoxy-1H-pyridin-4-one. InChIKey: KASNHLCKYKIKNL-QPJJXVBHSA-N.
| Molecular formula | C15H11BrClNO3 |
|---|---|
| Molecular weight | 368.61 g/mol |
| IUPAC name | 3-[(E)-3-(4-bromophenyl)prop-2-enoyl]-6-chloro-2-methoxy-1H-pyridin-4-one |
| InChIKey | KASNHLCKYKIKNL-QPJJXVBHSA-N |
| SMILES | COC1=C(C(=O)C=C(N1)Cl)C(=O)/C=C/C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)