CAS 2098215-62-2 is the registry number for 2-(2-Fluoro-6-isopropylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98+%. Offered by: AmBeed. Available pack sizes: 1g.
2-(2-fluoro-6-propan-2-ylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2098215-62-2) is a chemical compound with the molecular formula C15H22BFO2 and a molecular weight of 264.15 g/mol. IUPAC name: 2-(2-fluoro-6-propan-2-ylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: ZICJWGDNCRIRQP-UHFFFAOYSA-N.
| Molecular formula | C15H22BFO2 |
|---|---|
| Molecular weight | 264.15 g/mol |
| IUPAC name | 2-(2-fluoro-6-propan-2-ylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | ZICJWGDNCRIRQP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC=C2F)C(C)C |
Computed by PubChem (NCBI)