Products 209848-82-8

CAS 209848-82-8 is the registry number for Neopentyl 2-chloro-2-oxoacetate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2,2-dimethylpropyl 2-chloro-2-oxoacetate (CAS 209848-82-8) is a chemical compound with the molecular formula C7H11ClO3 and a molecular weight of 178.61 g/mol. IUPAC name: 2,2-dimethylpropyl 2-chloro-2-oxoacetate. InChIKey: GRQMQMYLDVISCB-UHFFFAOYSA-N.

Identity
Molecular formulaC7H11ClO3
Molecular weight178.61 g/mol
IUPAC name2,2-dimethylpropyl 2-chloro-2-oxoacetate
InChIKeyGRQMQMYLDVISCB-UHFFFAOYSA-N
SMILESCC(C)(C)COC(=O)C(=O)Cl

Computed by PubChem (NCBI)