CAS 2098489-71-3 is the registry number for (S)-4-((Benzyloxy)carbonyl)-1,4-oxazepane-2-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-4-phenylmethoxycarbonyl-1,4-oxazepane-2-carboxylic acid (CAS 2098489-71-3) is a chemical compound with the molecular formula C14H17NO5 and a molecular weight of 279.29 g/mol. IUPAC name: (2S)-4-phenylmethoxycarbonyl-1,4-oxazepane-2-carboxylic acid. InChIKey: AJQVXDQJBBKRTD-LBPRGKRZSA-N.
| Molecular formula | C14H17NO5 |
|---|---|
| Molecular weight | 279.29 g/mol |
| IUPAC name | (2S)-4-phenylmethoxycarbonyl-1,4-oxazepane-2-carboxylic acid |
| InChIKey | AJQVXDQJBBKRTD-LBPRGKRZSA-N |
| SMILES | C1CN(C[C@H](OC1)C(=O)O)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)