Products 2098492-26-1
CAS 2098492-26-1 is the registry number for Dimethyl 3-hydroxyphthalate-amido-C4-N3. Offered by: MedChemExpress. Available pack sizes: Get quote.
Dimethyl 3-[2-(4-azidobutylamino)-2-oxoethoxy]benzene-1,2-dicarboxylate (CAS 2098492-26-1) is a chemical compound with the molecular formula C16H20N4O6 and a molecular weight of 364.35 g/mol. IUPAC name: dimethyl 3-[2-(4-azidobutylamino)-2-oxoethoxy]benzene-1,2-dicarboxylate. InChIKey: OCHRFWNYKLMSGR-UHFFFAOYSA-N.
| Molecular formula | C16H20N4O6 |
|---|---|
| Molecular weight | 364.35 g/mol |
| IUPAC name | dimethyl 3-[2-(4-azidobutylamino)-2-oxoethoxy]benzene-1,2-dicarboxylate |
| InChIKey | OCHRFWNYKLMSGR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC=C1)OCC(=O)NCCCCN=[N+]=[N-])C(=O)OC |
Computed by PubChem (NCBI)