CAS 2098496-77-4 is the registry number for 5'-Iodo-2',3'-dideoxycytidine, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
4-amino-1-[(2R,5S)-5-(iodomethyl)oxolan-2-yl]pyrimidin-2-one (CAS 2098496-77-4) is a chemical compound with the molecular formula C9H12IN3O2 and a molecular weight of 321.11 g/mol. IUPAC name: 4-amino-1-[(2R,5S)-5-(iodomethyl)oxolan-2-yl]pyrimidin-2-one. InChIKey: CUFJFFSTFXKKLP-POYBYMJQSA-N.
| Molecular formula | C9H12IN3O2 |
|---|---|
| Molecular weight | 321.11 g/mol |
| IUPAC name | 4-amino-1-[(2R,5S)-5-(iodomethyl)oxolan-2-yl]pyrimidin-2-one |
| InChIKey | CUFJFFSTFXKKLP-POYBYMJQSA-N |
| SMILES | C1C[C@@H](O[C@@H]1CI)N2C=CC(=NC2=O)N |
Computed by PubChem (NCBI)